CAS 118162-46-2

Formula: C15H29N3O2

InChI: InChI=1S/C15H29N3O2/c16-18-17-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15(19)20/h1-14H2,(H,19,20)

InChI key: PYGQAGHMXCCROO-UHFFFAOYSA-N

SMILES: C(CCCCCCCN=[N+]=[N-])CCCCCCC(=O)O

Azido Palmitic Acid

CAS: 118162-46-2

Azido Palmitic Acid

Formula: C₁₅H₂₉N₃O₂

Molecular weight: 283.42

Ref: 54-BIPG2615

15-Azido-pentadecanoic acid

CAS: 118162-46-2

Formula: C₁₅H₂₉N₃O₂

Purity: 99%

Color and Shape: Solid

Molecular weight: 283.4097

Ref: IN-DA01JLY0

Azido palmitic acid

CAS: 118162-46-2

Azido palmitic acid is a lipid linker containing an azide group that reacts via click chemistry to form the conjugate. Its cleavability depends on the bioconjugate/ADC structure and cellular environment.

Formula: C₁₅H₂₉N₃O₂

Purity: Min. 95%

Molecular weight: 283.41 g/mol

Ref: 3D-TEA16246

15-Azido-pentadecanoic acid

CAS: 118162-46-2

15-Azido-pentadecanoic acid, also known as Azido Palmitic Acid, serves as a click chemistry reagent due to its azide group. This compound is instrumental in the identification and characterization of post-translationally palmitylated proteins through a straightforward two-step labeling and detection methodology [1]. It can partake in copper-catalyzed azide-alkyne cycloaddition reactions (CuAAc) with alkyne-bearing molecules and also engage in strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules featuring DBCO or BCN groups, showcasing its versatility in biochemical applications.

Formula: C₁₅H₂₉N₃O₂

Color and Shape: Solid

Molecular weight: 283.41

Ref: TM-T84775