CymitQuimica logo

CAS 118164-50-4

:

TRANS,TRANS-4-(3,4-DIFLUOROPHENYL)-4'-ETHYL-BICYCLOHEXYL

Description:
TRANS,TRANS-4-(3,4-DIFLUOROPHENYL)-4'-ETHYL-BICYCLOHEXYL is a chemical compound characterized by its unique bicyclic structure, which incorporates both ethyl and difluorophenyl groups. This compound features a trans configuration, indicating that the substituents are positioned opposite each other across the central bond, which can influence its physical and chemical properties, such as stability and reactivity. The presence of the difluorophenyl group introduces electronegative fluorine atoms, which can enhance the compound's lipophilicity and potentially affect its interaction with biological systems. The bicyclohexyl framework contributes to the rigidity of the molecule, which may impact its conformational flexibility and overall molecular interactions. This compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and as a building block for more complex molecular architectures. As with many organic compounds, its behavior in different solvents and under various conditions can provide insights into its reactivity and potential uses.
Formula:C20H28F2
InChI:InChI=1/C20H28F2/c1-2-14-3-5-15(6-4-14)16-7-9-17(10-8-16)18-11-12-19(21)20(22)13-18/h11-17H,2-10H2,1H3/t14-,15-,16-,17-
InChI key:WDECTZREPSJUQW-UHFFFAOYSA-N
SMILES:CC[C@H]1CC[C@@H](CC1)[C@H]1CC[C@@H](CC1)c1ccc(c(c1)F)F
Synonyms:
  • (1r,1'r,4R,4'R)-4-(3,4-difluorophenyl)-4'-ethyl-1,1'-bi(cyclohexyl)
  • 4-[(Trans,trans)-4'-ethyl[1,1'-bicyclohexyl]-4-yl]-1,2-difluorobenzene
  • trans,trans-4-(3,4-Difluorophenyl)-4''-ethyl-bicyclohexyl
Found 5 products.