CymitQuimica logo

CAS 118176-37-7

:

2,2-dimethyltetrahydropyrazine-1,4-diol

Description:
2,2-Dimethyltetrahydropyrazine-1,4-diol is a chemical compound characterized by its unique bicyclic structure, which includes a pyrazine ring and two hydroxyl (-OH) groups. This compound is a derivative of tetrahydropyrazine, featuring two methyl groups attached to the nitrogen atoms of the pyrazine ring, contributing to its stability and solubility in various solvents. The presence of hydroxyl groups enhances its reactivity, making it a potential candidate for various chemical reactions, including those involving hydrogen bonding and nucleophilic attacks. It is often studied for its potential applications in pharmaceuticals and agrochemicals due to its biological activity. The compound's molecular structure allows for various conformations, influencing its physical properties such as melting point, boiling point, and solubility. Additionally, its CAS number, 118176-37-7, serves as a unique identifier in chemical databases, facilitating research and regulatory compliance. Overall, 2,2-dimethyltetrahydropyrazine-1,4-diol is of interest in both synthetic and applied chemistry contexts.
Formula:C6H14N2O2
InChI:InChI=1/C6H14N2O2/c1-6(2)5-7(9)3-4-8(6)10/h9-10H,3-5H2,1-2H3
SMILES:CC1(C)CN(CCN1O)O
Synonyms:
  • 2,2-Dimethylpiperazine-1,4-Diol
Found 1 products.