CymitQuimica logo

CAS 1181816-12-5

:

tert-butyl 6-oxo-2-azaspiro[3.3]heptane-2-carboxylate

Description:
Tert-butyl 6-oxo-2-azaspiro[3.3]heptane-2-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which includes a nitrogen atom within a bicyclic framework. This compound features a tert-butyl ester functional group, contributing to its solubility and reactivity. The presence of the 6-oxo group indicates a carbonyl functionality, which can participate in various chemical reactions, such as nucleophilic additions or reductions. The azaspiro structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to mimic complex biological molecules. Additionally, the compound's carboxylate group may enhance its interaction with biological targets. Its molecular properties, such as boiling point, melting point, and solubility, would depend on the specific conditions and solvent used. Overall, tert-butyl 6-oxo-2-azaspiro[3.3]heptane-2-carboxylate represents a versatile scaffold for further chemical modifications and potential applications in drug discovery and development.
Formula:C11H17NO3
InChI:InChI=1S/C11H17NO3/c1-10(2,3)15-9(14)12-6-11(7-12)4-8(13)5-11/h4-7H2,1-3H3
InChI key:HQHRAGXKFOTSQE-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CC2(C1)CC(=O)C2
Synonyms:
  • 6-Oxo-2-Azaspiro[3.3]Heptane-2-Carboxylic Acid Tert-Butyl Ester
  • Tert-Butyl 6-Oxo-2-Azaspiro[3.4]Octane-2-Carboxylate
Found 6 products.