CymitQuimica logo

CAS 1181816-13-6

:

Ethyl 1-cyano-3-(phenylmethoxy)cyclobutanecarboxylate

Description:
Ethyl 1-cyano-3-(phenylmethoxy)cyclobutanecarboxylate is a chemical compound characterized by its unique structure, which includes a cyclobutane ring, a cyano group, and an ethyl ester functional group. This compound features a phenylmethoxy substituent, which contributes to its potential reactivity and solubility properties. The presence of the cyano group typically indicates that the compound may exhibit polar characteristics, influencing its interactions in various chemical environments. Ethyl 1-cyano-3-(phenylmethoxy)cyclobutanecarboxylate may be of interest in organic synthesis and medicinal chemistry due to its structural motifs that can be modified for various applications. Its molecular structure suggests potential for diverse reactivity, including nucleophilic substitutions and cycloaddition reactions. Additionally, the compound's properties, such as boiling point, melting point, and solubility, would depend on the specific conditions and the presence of other functional groups. Overall, this compound represents a fascinating area of study within the realm of organic chemistry, particularly for those exploring novel synthetic pathways or pharmacological applications.
Formula:C15H17NO3
InChI:InChI=1S/C15H17NO3/c1-2-18-14(17)15(11-16)8-13(9-15)19-10-12-6-4-3-5-7-12/h3-7,13H,2,8-10H2,1H3
InChI key:InChIKey=HELWVAKDFIDWJS-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1(C#N)CC(OCC2=CC=CC=C2)C1
Synonyms:
  • Cyclobutanecarboxylic acid, 1-cyano-3-(phenylmethoxy)-, ethyl ester
  • Ethyl 1-cyano-3-(phenylmethoxy)cyclobutanecarboxylate
  • 3-Benzyloxy-1-cyano-cyclobutanecarboxylic acid ethyl ester
Found 3 products.