CymitQuimica logo

CAS 118184-65-9

:

Benzenemethanamine, 4-cyclopropyl-, hydrochloride (1:1)

Description:
Benzenemethanamine, 4-cyclopropyl-, hydrochloride (1:1), also known by its CAS number 118184-65-9, is a chemical compound characterized by its amine functional group and a cyclopropyl substituent on the benzene ring. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The presence of the cyclopropyl group can influence its chemical reactivity and biological activity, making it of interest in medicinal chemistry and pharmacology. As a hydrochloride salt, it is often used in research and pharmaceutical applications, where stability and solubility are critical. The compound's structure suggests potential interactions with biological targets, which may lead to various pharmacological effects. However, specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C10H13N·ClH
InChI:InChI=1S/C10H13N.ClH/c11-7-8-1-3-9(4-2-8)10-5-6-10;/h1-4,10H,5-7,11H2;1H
InChI key:InChIKey=GQKQDZQZXNXCRP-UHFFFAOYSA-N
SMILES:C(N)C1=CC=C(C=C1)C2CC2.Cl
Synonyms:
  • Benzenemethanamine, 4-cyclopropyl-, hydrochloride
  • p-Cyclopropylbenzylamine hydrochloride
  • (4-Cyclopropylphenyl)methanamine hydrochloride
  • Benzenemethanamine, 4-cyclopropyl-, hydrochloride (1:1)
Found 5 products.