CymitQuimica logo

CAS 118184-66-0

:

2-Cyclopropylbenzenemethanamine

Description:
2-Cyclopropylbenzenemethanamine, also known by its CAS number 118184-66-0, is an organic compound characterized by the presence of a cyclopropyl group attached to a benzene ring, with an amine functional group. This compound features a cyclopropyl moiety, which is a three-membered carbon ring, contributing to its unique steric and electronic properties. The amine group indicates that it can participate in hydrogen bonding, making it potentially soluble in polar solvents. The presence of the benzene ring suggests that it may exhibit aromatic characteristics, including stability and reactivity typical of aromatic compounds. Additionally, the compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can influence biological activity. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific interactions of its functional groups and the overall molecular structure. As with many amines, it may also exhibit basicity, allowing it to interact with acids to form salts.
Formula:C10H13N
InChI:InChI=1S/C10H13N/c11-7-9-3-1-2-4-10(9)8-5-6-8/h1-4,8H,5-7,11H2
InChI key:InChIKey=XSUSWKYDSROWDL-UHFFFAOYSA-N
SMILES:C(N)C1=C(C=CC=C1)C2CC2
Synonyms:
  • (2-Cyclopropylphenyl)methanamine
  • Benzenemethanamine, 2-cyclopropyl-
  • 2-Cyclopropylbenzenemethanamine
  • 2-Cyclopropylbenzylamine 95+%
Found 4 products.