CymitQuimica logo

CAS 118220-71-6

:

6-Fluorobenzothiazole

Description:
6-Fluorobenzothiazole is a heterocyclic compound characterized by the presence of both a benzene ring and a thiazole ring, with a fluorine atom substituted at the sixth position of the benzothiazole structure. This compound typically exhibits a pale yellow to light brown appearance and is known for its aromatic properties, which contribute to its stability and reactivity. It is soluble in organic solvents but has limited solubility in water, reflecting its hydrophobic nature. The presence of the fluorine atom enhances its electronic properties, making it useful in various applications, including pharmaceuticals and agrochemicals. 6-Fluorobenzothiazole can participate in nucleophilic substitution reactions due to the electrophilic nature of the fluorine atom, allowing for further functionalization. Additionally, it may exhibit biological activity, making it a subject of interest in medicinal chemistry. Safety data indicates that, like many fluorinated compounds, it should be handled with care due to potential toxicity and environmental impact.
Formula:C7H4FNS
InChI:InChI=1S/C7H4FNS/c8-5-1-2-6-7(3-5)10-4-9-6/h1-4H
InChI key:InChIKey=BGSRFMFTXMPTSC-UHFFFAOYSA-N
SMILES:FC=1C=C2C(=CC1)N=CS2
Synonyms:
  • 6-Fluoro-1,3-benzothiazole
  • 6-Fluoro-benzothiazole
  • Benzothiazole, 6-fluoro-
  • 6-Fluorobenzothiazole
Found 4 products.