CymitQuimica logo

CAS 1182284-45-2

:

Piperidine, 4-(chloromethyl)-1-methyl-,hydrochloride (1:1)

Description:
Piperidine, 4-(chloromethyl)-1-methyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a chloromethyl group at the 4-position and a methyl group at the 1-position contributes to its unique reactivity and properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its stability and solubility in polar solvents, particularly water. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its molecular structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. Safety data should be consulted, as the chloromethyl group can be reactive and may pose hazards. Overall, this compound's characteristics make it a subject of interest in various chemical and pharmaceutical research contexts.
Formula:C7H14ClN・ClH
InChI:InChI=1S/C7H14ClN.ClH/c1-9-4-2-7(6-8)3-5-9;/h7H,2-6H2,1H3;1H
InChI key:NIXLUDKORJXUEV-UHFFFAOYSA-N
SMILES:CN1CCC(CC1)CCl.Cl
Found 4 products.