CymitQuimica logo

CAS 1182284-46-3

:

Methyl 2-(acetylamino)-4-bromobenzeneacetate

Description:
Methyl 2-(acetylamino)-4-bromobenzeneacetate is an organic compound characterized by its complex structure, which includes a bromobenzene ring substituted with an acetylamino group and an ester functional group. The presence of the bromine atom introduces notable electrophilic properties, making it reactive in various chemical reactions. The acetylamino group contributes to the compound's potential as a building block in pharmaceutical synthesis, as it can participate in amide bond formation. The methyl ester group enhances the compound's solubility in organic solvents, facilitating its use in synthetic applications. This compound is likely to exhibit moderate to high stability under standard conditions, although it may be sensitive to hydrolysis due to the ester functionality. Additionally, its molecular structure suggests potential biological activity, which could be explored in medicinal chemistry. Overall, Methyl 2-(acetylamino)-4-bromobenzeneacetate is a versatile compound with applications in organic synthesis and potentially in drug development.
Formula:C11H12BrNO3
InChI:InChI=1S/C11H12BrNO3/c1-7(14)13-10-6-9(12)4-3-8(10)5-11(15)16-2/h3-4,6H,5H2,1-2H3,(H,13,14)
InChI key:InChIKey=LCQMFPAASSGQFD-UHFFFAOYSA-N
SMILES:C(C(OC)=O)C1=C(NC(C)=O)C=C(Br)C=C1
Synonyms:
  • Benzeneacetic acid, 2-(acetylamino)-4-bromo-, methyl ester
  • Methyl 2-(acetylamino)-4-bromobenzeneacetate
Found 1 products.