CymitQuimica logo

CAS 1182349-12-7

:

4-Cyanobenzo[b]thiophene-2-carboxylic acid

Description:
4-Cyanobenzo[b]thiophene-2-carboxylic acid is an organic compound characterized by its unique structure, which includes a thiophene ring fused to a benzene ring, along with a carboxylic acid and a cyano group. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the carboxylic acid functional group, while its aromatic system contributes to its stability and potential for π-π stacking interactions. The cyano group enhances its electronic properties, making it useful in various applications, including organic electronics and materials science. Additionally, the presence of both electron-withdrawing and electron-donating groups in its structure can influence its reactivity and interaction with other chemical species. The compound may also exhibit interesting photophysical properties, making it a candidate for studies in fluorescence and photochemistry. Overall, 4-Cyanobenzo[b]thiophene-2-carboxylic acid is a versatile compound with potential applications in advanced materials and organic synthesis.
Formula:C10H5NO2S
InChI:InChI=1S/C10H5NO2S/c11-5-6-2-1-3-8-7(6)4-9(14-8)10(12)13/h1-4H,(H,12,13)
InChI key:VBBNNPMFELXELE-UHFFFAOYSA-N
SMILES:C1=CC(=C2C=C(SC2=C1)C(=O)O)C#N
Synonyms:
  • 4-cyano-1-benzothiophene-2-carboxylic acid
  • 4-Cyanobenzo[b]thiophene-2-carboxylic acid
  • Benzo[b]thiophene-2-carboxylic acid, 4-cyano-
  • 4-cyanobenzothiophene-2-carboxylic acid
Found 2 products.