CAS 118266-99-2

Formula: C20H20O4

InChI: InChI=1S/C20H20O4/c1-20(2)12-11-16-18(23)10-8-15(19(16)24-20)17(22)9-5-13-3-6-14(21)7-4-13/h3-10,21,23H,11-12H2,1-2H3/b9-5+

InChI key: SEDVPKQZRCGYNR-WEVVVXLNSA-N

SMILES: CC1(CCC2=C(C=CC(=C2O1)C(=O)/C=C/C3=CC=C(C=C3)O)O)C

Isodorsmanin A

CAS: 118266-99-2

Isodorsmanin A

Formula: C₂₀H₂₀O₄

Purity: HP≥98%

Molecular weight: 324.37

Ref: 54-OR1141174

Isodorsmanin A

CAS: 118266-99-2

Formula: C₂₀H₂₀O₄

Color and Shape: Solid

Molecular weight: 324.3704

Ref: IN-DA00930J

Isodorsmanin A

CAS: 118266-99-2

Isodorsmanin A is a natural product for research related to life sciences. The catalog number is TN4285 and the CAS number is 118266-99-2.

Formula: C₂₀H₂₀O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 324.37

Ref: TM-TN4285

Isodorsmanin A

CAS: 118266-99-2

Formula: C₂₀H₂₀O₄

Purity: 95%~99%

Molecular weight: 324.376

Ref: BP-SBP03015

Isodorsmanin A

CAS: 118266-99-2

Isodorsmanin A is a daphnane diterpenoid, which is a class of bioactive compounds. It is derived from the plant Wikstroemia indica, a species known for its rich phytochemical profile. The compound exerts its effects primarily through the inhibition of protein kinase C (PKC), a crucial enzyme involved in various cellular processes such as proliferation and apoptosis. By modulating PKC activity, Isodorsmanin A disrupts key signaling pathways, leading to the induction of apoptosis in cancer cells.

Formula: C₂₀H₂₀O₄

Purity: Min. 95%

Molecular weight: 324.4 g/mol

Ref: 3D-TEA26699