CymitQuimica logo

CAS 1182709-86-9

:

2,6-Dichloro-4-fluorobenzaldehyde

Description:
2,6-Dichloro-4-fluorobenzaldehyde is an aromatic aldehyde characterized by the presence of two chlorine atoms and one fluorine atom attached to a benzene ring, along with an aldehyde functional group (-CHO). This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as ethanol and dichloromethane, but has limited solubility in water due to its hydrophobic aromatic structure. The presence of halogen substituents can influence its reactivity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Its molecular structure contributes to its potential applications in various chemical reactions, including electrophilic aromatic substitution and nucleophilic addition. Additionally, the compound may exhibit specific physical properties such as a distinct melting point and boiling point, which are important for its handling and storage. Safety data should be consulted, as halogenated compounds can pose health risks and environmental concerns.
Formula:C7H3Cl2FO
InChI:InChI=1S/C7H3Cl2FO/c8-6-1-4(10)2-7(9)5(6)3-11/h1-3H
InChI key:UOQMGQYMDHYXTB-UHFFFAOYSA-N
SMILES:C1=C(C=C(C(=C1Cl)C=O)Cl)F
Found 4 products.