CymitQuimica logo

CAS 118337-33-0

:

2-bromo-1-(3-methylbenzo[b]thiophen-2-yl)ethan-1-one

Description:
2-bromo-1-(3-methylbenzo[b]thiophen-2-yl)ethan-1-one, with the CAS number 118337-33-0, is an organic compound characterized by its unique structure that includes a bromine atom and a ketone functional group. This compound features a 3-methylbenzo[b]thiophene moiety, which contributes to its aromatic properties and potential biological activity. The presence of the bromine atom enhances its reactivity, making it a useful intermediate in various synthetic applications. Typically, compounds of this nature exhibit moderate to high lipophilicity due to their aromatic and heterocyclic components, which can influence their solubility in organic solvents. Additionally, the compound may exhibit interesting electronic properties due to the conjugation between the aromatic systems and the carbonyl group. Its potential applications could span across pharmaceuticals, agrochemicals, or materials science, depending on its reactivity and the specific functional groups present. As with many brominated compounds, considerations regarding environmental impact and toxicity are essential in its handling and application.
Formula:C11H8BrClOS
InChI:InChI=1/C11H8BrClOS/c1-6-8-4-7(13)2-3-10(8)15-11(6)9(14)5-12/h2-4H,5H2,1H3
InChI key:PIQSJBQPXDKSHF-UHFFFAOYSA-N
SMILES:Cc1c2cc(ccc2sc1C(=O)CBr)Cl
Synonyms:
  • 2-Bromo-1-(3-Methyl-1-Benzothiophen-2-Yl)Ethanone
  • 2-Bromo-1-(5-Chloro-3-Methyl-1-Benzothiophen-2-Yl)Ethanone
Found 4 products.