CymitQuimica logo

CAS 1183538-72-8

:

2-Amino-2-(3-thienyl)ethanol

Description:
2-Amino-2-(3-thienyl)ethanol is an organic compound characterized by the presence of both an amino group and a hydroxyl group attached to a carbon chain that also includes a thienyl ring. The thienyl group, derived from thiophene, contributes to the compound's aromatic properties and potential reactivity. This compound typically exhibits polar characteristics due to the hydroxyl and amino functional groups, which can engage in hydrogen bonding, influencing its solubility in polar solvents. The presence of the thienyl moiety may also impart unique electronic properties, making it of interest in various chemical applications, including pharmaceuticals and materials science. Additionally, the compound's structure suggests potential biological activity, which could be explored in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be studied for its reactivity and interactions with other chemical species. Overall, 2-Amino-2-(3-thienyl)ethanol represents a versatile compound with potential applications in diverse fields.
Formula:C6H9NOS
InChI:InChI=1S/C6H9NOS/c7-6(3-8)5-1-2-9-4-5/h1-2,4,6,8H,3,7H2
SMILES:c1cscc1C(CO)N
Found 1 products.