CAS 118357-32-7
:6-((4,6-dichlorotriazin-2-yl)amino)*fluorescein H
Description:
6-((4,6-Dichlorotriazin-2-yl)amino)fluorescein H, with CAS number 118357-32-7, is a chemical compound that belongs to the class of fluorescein derivatives. This substance is characterized by its vivid fluorescent properties, which make it useful in various applications, including biological staining and as a fluorescent marker in research. The presence of the triazine moiety contributes to its reactivity, allowing it to form stable conjugates with amines and other nucleophiles. The dichlorotriazine group enhances its ability to covalently bond to biomolecules, facilitating the labeling of proteins or nucleic acids. Additionally, the compound exhibits solubility in polar solvents, which is advantageous for its use in aqueous biological systems. Its fluorescence can be excited by specific wavelengths of light, making it a valuable tool in microscopy and flow cytometry. Overall, 6-((4,6-dichlorotriazin-2-yl)amino)fluorescein H is a versatile compound with significant utility in biochemical and analytical applications.
Formula:C23H12Cl2N4O5.HCl
InChI:InChI=1S/C23H12Cl2N4O5.ClH/c24-20-27-21(25)29-22(28-20)26-10-1-4-13-16(7-10)23(34-19(13)32)14-5-2-11(30)8-17(14)33-18-9-12(31)3-6-15(18)23;/h1-9,30-31H,(H,26,27,28,29);1H
InChI key:YCNJSGSAWXHZEO-UHFFFAOYSA-N
SMILES:C1=CC2=C(C=C1NC3=NC(=NC(=N3)Cl)Cl)C4(C5=C(C=C(C=C5)O)OC6=C4C=CC(=C6)O)OC2=O.Cl
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
6-((4,6-Dichloro-1,3,5-triazin-2-yl)amino)-3',6'-dihydroxy-3H-spiro[isobenzofuran-1,9'-xanthen]-3-one hydrochloride
CAS:Formula:C23H13Cl3N4O5Molecular weight:531.7321
