CymitQuimica logo

CAS 118358-80-8

:

Tetra-O-acetyl-a-Mannosyl-Fmocserine

Description:
Tetra-O-acetyl-α-mannosyl-Fmocserine is a chemical compound that serves as a glycosyl donor in carbohydrate chemistry and is often utilized in the synthesis of glycopeptides and glycoproteins. This compound features a mannosyl moiety, which is a sugar derived from mannose, acetylated at four hydroxyl groups, enhancing its stability and solubility. The Fmoc (9-fluorenylmethoxycarbonyl) group is a protective group commonly used in peptide synthesis, providing a means to selectively protect the amino group of serine while allowing for further chemical modifications. The presence of the acetyl groups contributes to the overall lipophilicity of the molecule, which can influence its reactivity and interaction with other biomolecules. The compound is typically used in research settings, particularly in the development of carbohydrate-based therapeutics and in the study of glycosylation processes. Its unique structure allows for specific interactions in biological systems, making it a valuable tool in synthetic organic chemistry and biochemistry.
Formula:C32H35NO14
InChI:InChI=1S/C32H35NO14/c1-16(34)41-15-26-27(44-17(2)35)28(45-18(3)36)29(46-19(4)37)31(47-26)42-14-25(30(38)39)33-32(40)43-13-24-22-11-7-5-9-20(22)21-10-6-8-12-23(21)24/h5-12,24-29,31H,13-15H2,1-4H3,(H,33,40)(H,38,39)/t25-,26+,27+,28-,29-,31-/m0/s1
InChI key:UGQPZVSWEMKXBN-YVMRMMKNSA-N
SMILES:CC(=O)OC[C@@H]1[C@H]([C@@H]([C@@H]([C@H](O1)OC[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)OC(=O)C)OC(=O)C)OC(=O)C
Found 6 products.