CAS 118358-80-8
:Tetra-O-acetyl-a-Mannosyl-Fmocserine
Description:
Tetra-O-acetyl-α-mannosyl-Fmocserine is a chemical compound that serves as a glycosyl donor in carbohydrate chemistry and is often utilized in the synthesis of glycopeptides and glycoproteins. This compound features a mannosyl moiety, which is a sugar derived from mannose, acetylated at four hydroxyl groups, enhancing its stability and solubility. The Fmoc (9-fluorenylmethoxycarbonyl) group is a protective group commonly used in peptide synthesis, providing a means to selectively protect the amino group of serine while allowing for further chemical modifications. The presence of the acetyl groups contributes to the overall lipophilicity of the molecule, which can influence its reactivity and interaction with other biomolecules. The compound is typically used in research settings, particularly in the development of carbohydrate-based therapeutics and in the study of glycosylation processes. Its unique structure allows for specific interactions in biological systems, making it a valuable tool in synthetic organic chemistry and biochemistry.
Formula:C32H35NO14
InChI:InChI=1S/C32H35NO14/c1-16(34)41-15-26-27(44-17(2)35)28(45-18(3)36)29(46-19(4)37)31(47-26)42-14-25(30(38)39)33-32(40)43-13-24-22-11-7-5-9-20(22)21-10-6-8-12-23(21)24/h5-12,24-29,31H,13-15H2,1-4H3,(H,33,40)(H,38,39)/t25-,26+,27+,28-,29-,31-/m0/s1
InChI key:UGQPZVSWEMKXBN-YVMRMMKNSA-N
SMILES:CC(=O)OC[C@@H]1[C@H]([C@@H]([C@@H]([C@H](O1)OC[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)OC(=O)C)OC(=O)C)OC(=O)C
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2,3,4,6-Tetra-O-acetyl-α-D-mannopyranosyl-Fmoc Serine
CAS:2,3,4,6-Tetra-O-acetyl-α-D-mannopyranosyl-Fmoc SerineFormula:C32H35NO14Purity:95%Molecular weight:657.622,3,4,6-Tetra-O-acetyl-α-D-mannopyranosyl-Fmoc serine
CAS:2,3,4,6-Tetra-O-acetyl-a-D-mannopyranosyl-Fmoc serine is a sugar that is synthesized from the natural amino acid serine. It is a modified sugar that has been fluorinated and acetylated on the 4th carbon position. The Fmoc protecting group was removed through a click modification to yield 2,3,4,6-Tetra-O-acetyl-a-D-mannopyranosyl serine. This glycoconjugate can be used for glycosylation or methylation of proteins or peptides. This sugar has been shown to have antihypertensive effects in animal models and has been used as an adjuvant therapy in cancer treatment.Formula:C32H35NO14Purity:Min. 95%Color and Shape:PowderMolecular weight:657.63 g/mol2,3,4,6-Tetra-O-acetyl-α-D-mannopyranosyl-Fmoc Serine
CAS:Purity:95%Color and Shape:SolidMolecular weight:657.212,3,4,6-Tetra-O-acetyl-α-D-mannopyranosyl-Fmoc Serine
CAS:Controlled ProductFormula:C32H35NO14Color and Shape:NeatMolecular weight:657.619






