CymitQuimica logo

CAS 118373-82-3

:

chloroorienticin C

Description:
Chloroorienticin C, with the CAS number 118373-82-3, is a chemical compound that belongs to the class of natural products known as flavonoids. It is characterized by its complex polyphenolic structure, which typically includes multiple hydroxyl groups and aromatic rings, contributing to its potential biological activities. This compound is often studied for its antioxidant properties, which may help in neutralizing free radicals and reducing oxidative stress in biological systems. Additionally, chloroorienticin C may exhibit various pharmacological effects, including anti-inflammatory and antimicrobial activities, making it of interest in medicinal chemistry and natural product research. Its solubility, stability, and reactivity can vary depending on the specific conditions, such as pH and solvent used. As with many flavonoids, its bioavailability and efficacy in biological systems can be influenced by factors like metabolism and interaction with other compounds. Overall, chloroorienticin C represents a fascinating area of study within the field of natural products and their potential health benefits.
Formula:C60H65Cl2N9O19
InChI:InChI=1/C60H65Cl2N9O19/c1-22(2)12-33(65-5)53(79)70-47-49(76)25-7-10-37(31(61)14-25)88-39-16-27-17-40(50(39)77)89-38-11-8-26(15-32(38)62)51(90-42-21-60(4,64)52(78)23(3)87-42)48-58(84)69-46(59(85)86)30-18-28(72)19-36(74)43(30)29-13-24(6-9-35(29)73)44(55(81)71-48)68-56(82)45(27)67-54(80)34(20-41(63)75)66-57(47)83/h6-11,13-19,22-23,33-34,42,44-49,51-52,65,72-74,76-78H,12,20-21,64H2,1-5H3,(H2,63,75)(H,66,83)(H,67,80)(H,68,82)(H,69,84)(H,70,79)(H,71,81)(H,85,86)
InChI key:CHSINQSLUWRGER-UHFFFAOYSA-N
SMILES:CC1C(C(CC(O1)OC2C3C(=O)NC(C4=C(C(=CC(=C4)O)O)C5=C(C=CC(=C5)C(C(=O)N3)NC(=O)C6C7=CC(=C(C(=C7)OC8=C(C=C2C=C8)Cl)O)OC9=C(C=C(C=C9)C(C(C(=O)NC(C(=O)N6)CC(=O)N)NC(=O)C(CC(C)C)NC)O)Cl)O)C(=O)O)(C)N)O
Synonyms:
  • 2-[(4-amino-5-hydroxy-4,6-dimethyltetrahydro-2H-pyran-2-yl)oxy]-22-(2-amino-2-oxoethyl)-5,15-dichloro-18,32,35,37,48-pentahydroxy-19-{[4-methyl-2-(methylamino)pentanoyl]amino}-20,23,26,42,44-pentaoxo-7,13-dioxa-21,24,27,41,43-pentaazaoctacyclo[26.14.2.2~3,6~.2~14,17~.1~8,12~.1~29,33~.0~10,25~.0~34,39~]pentaconta-3,5,8(48),9,11,14,16,29(45),30,32,34,36,38,46,49-pentadecaene-40-carboxylic acid (non-preferred name)
  • Vancomycin, 22-O-(3-amino-2,3,6-trideoxy-3-C-methyl-alpha-L-arabino-hexopyranosyl)-14-O-de(2-O-(3-amino-2,3,6-trideoxy-3-C-methyl-alpha-L-arabino-hexopyranosyl)-beta-D-glucopyranosyl)-
  • Chloroorienticin C
Found 1 products.