CAS 118380-84-0
:cytidine (N-pac)-ce phosphoramidite *for cyclone
Description:
Cytidine (N-pac)-ce phosphoramidite, with the CAS number 118380-84-0, is a chemical compound primarily used in the field of nucleic acid chemistry, particularly in the synthesis of oligonucleotides. This compound is a modified form of cytidine, which is one of the four nucleosides that make up RNA. The "N-pac" designation indicates that it has a protective group, typically used to prevent unwanted reactions during the synthesis process. The phosphoramidite functionality allows for the efficient coupling of nucleosides during the solid-phase synthesis of oligonucleotides, facilitating the formation of phosphodiester bonds. This compound is characterized by its ability to be incorporated into RNA sequences, making it valuable for research in molecular biology, genetics, and therapeutic applications. Its stability, reactivity, and compatibility with various coupling chemistries make it a crucial reagent in the synthesis of modified RNA molecules for applications such as RNA interference and antisense oligonucleotide therapies. Proper handling and storage conditions are essential to maintain its integrity and reactivity.
Formula:C53H68N5O9PSi
InChI:InChI=1S/C52H66N5O9PSi/c1-36(2)57(37(3)4)67(63-34-18-32-53)65-46-44(35-62-52(39-21-16-13-17-22-39,40-23-27-42(60-8)28-24-40)41-25-29-43(61-9)30-26-41)64-49(47(46)66-68(10,11)51(5,6)7)56-33-31-45(55-50(56)59)54-48(58)38-19-14-12-15-20-38/h12-17,19-31,33,36-37,44,46-47,49H,18,34-35H2,1-11H3,(H,54,55,58,59)/t44-,46-,47-,49-,67?/m1/s1
InChI key:VWNXEDLLHIFAOL-YOVDOAOFSA-N
SMILES:CC(C)N(C(C)C)P(OCCC#N)O[C@@H]1[C@H](O[C@H]([C@@H]1O[Si](C)(C)C(C)(C)C)N2C=CC(=NC2=O)NC(=O)C3=CC=CC=C3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC
Synonyms:- cytidine (C-N-bz)
- Bz-rC Phosphoramidite
- N-Blocked-5'-O-Dmt-2'-O-Tbdms Ced Cytidine Phosphoramidite
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
(2R,3R,4R,5R)-5-(4-Benzamido-2-oxopyrimidin-1(2H)-yl)-2-((bis(4-methoxyphenyl)(phenyl)methoxy)methyl)-4-((tert-butyldimethylsilyl)oxy)tetrahydrofuran-3-yl (2-cyanoethyl) diisopropylphosphoramidite
CAS:(2R,3R,4R,5R)-5-(4-Benzamido-2-oxopyrimidin-1(2H)-yl)-2-((bis(4-methoxyphenyl)(phenyl)methoxy)methyl)-4-((tert-butyldimethylsilyl)oxy)tetrahydrofuran-3-yl (2-cyanoethyl) diisopropylphosphoramiditeFormula:C52H66N5O9PSiPurity:95%Molecular weight:964.19Bz-rC Phosphoramidite
CAS:Formula:C52H66N5O9PSiPurity:95%Color and Shape:SolidMolecular weight:964.1678Bz-rC Phosphoramidite
CAS:Bz-rC Phosphoramidite is a phosphinamide monomer utilized for oligonucleotide synthesis.Formula:C52H66N5O9PSiColor and Shape:SolidMolecular weight:964.185Bz-rC Phosphoramidite
CAS:(2R,3R,4R,5R)-5-(4-Benzamido-2-oxopyrimidin-1(2H)-yl)-2-((bis(4-methoxyphenyl)(phenyl)methoxy)methyl)-4-((tert-butyldimethylsilyl)oxy)tetrahydrofuran-3-yl (2-cyanoethyl) diisopropylphosphoramiditeFormula:C52H66N5O9PSiPurity:95%Molecular weight:964.17N4-Benzoyl-2'-O-tert-butyldimethylsilyl-5'-O-DMT-cytidine 3'-CE phosphoramidite
CAS:N4-Benzoyl-2'-O-tert-butyldimethylsilyl-5'-O-DMT-cytidine 3'-CE phosphoramidite is a high purity, Ribonuclesides, Anticancer, High quality, Antiviral, Nucleosides, CAS No. 118380-84-0, Deoxyribonucleosides, Modified, monophosphate and Phosphoramidites. It is an important reagent for the synthesis of DNA and RNA oligonucleotides. This product has novel properties as an anticancer drug and antiviral agent.Formula:C52H66N5O9PSiPurity:Min. 95%Color and Shape:PowderMolecular weight:964.19 g/mol





