CAS 118392-79-3
:EN-2
Description:
EN-2, with the CAS number 118392-79-3, is a chemical compound that has garnered attention in various fields, particularly in medicinal chemistry and pharmacology. It is characterized by its specific molecular structure, which contributes to its biological activity. EN-2 is known to interact with certain biological targets, potentially influencing cellular processes. The compound may exhibit properties such as solubility in organic solvents and stability under standard laboratory conditions. Its synthesis typically involves multi-step organic reactions, and it may be analyzed using techniques like NMR spectroscopy and mass spectrometry to confirm its identity and purity. Additionally, EN-2's potential applications could range from research in drug development to studies in biochemical pathways, making it a subject of interest for scientists exploring new therapeutic agents. However, detailed safety and handling information should be consulted, as with any chemical substance, to ensure proper laboratory practices.
Formula:C32H30O7
InChI:InChI=1S/C32H30O7/c33-30-19-27-26(15-16-32(36-17-18-37-32)21-35-25-9-5-2-6-10-25)28(20-29(27)38-30)39-31(34)24-13-11-23(12-14-24)22-7-3-1-4-8-22/h1-16,26-29H,17-21H2/b16-15+
InChI key:RQTJQNBGKPAHOD-FOCLMDBBSA-N
SMILES:C1COC(O1)(COC2=CC=CC=C2)/C=C/C3C(CC4C3CC(=O)O4)OC(=O)C5=CC=C(C=C5)C6=CC=CC=C6
Synonyms:- [1,1'-Biphenyl]-4-Carboxylic Acid Hexahydro-2-Oxo-4-[2-[2-(Phenoxymethyl)-1,3-Dioxolan-2-Yl]Ethenyl]-2H-Cyclopenta[B]Furan-5-Yl Ester
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2-Oxo-4-(2-(2-(phenoxymethyl)-1,3-dioxolan-2-yl)vinyl)hexahydro-2H-cyclopenta[b]furan-5-yl [1,1'-biphenyl]-4-carboxylate
CAS:Formula:C32H30O7Molecular weight:526.5764
