CymitQuimica logo

CAS 118419-93-5

:

2-Propenoic acid, 3-(2-chloro-3-pyridinyl)-, (E)-

Description:
2-Propenoic acid, 3-(2-chloro-3-pyridinyl)-, (E)-, also known by its CAS number 118419-93-5, is an organic compound characterized by its structure, which includes a propenoic acid moiety and a pyridine ring substituted with a chlorine atom. This compound typically exhibits properties associated with both carboxylic acids and aromatic heterocycles. It is likely to be a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the propenoic acid group suggests it can participate in various chemical reactions, such as polymerization, making it useful in the synthesis of polymers and other derivatives. The chlorine substituent on the pyridine ring may impart specific reactivity and influence its biological activity, potentially making it of interest in pharmaceutical applications. Additionally, the (E)-configuration indicates the specific geometric arrangement of the substituents around the double bond, which can affect the compound's reactivity and interactions with other molecules. Overall, this compound's unique structure contributes to its potential utility in various chemical and medicinal contexts.
Formula:C8H6ClNO2
InChI:InChI=1S/C8H6ClNO2/c9-8-6(2-1-5-10-8)3-4-7(11)12/h1-5H,(H,11,12)/b4-3+
InChI key:PJLXTJJEXKSZAF-ONEGZZNKSA-N
SMILES:C1=CC(=C(N=C1)Cl)/C=C/C(=O)O
Found 4 products.