CymitQuimica logo

CAS 118420-05-6

:

3-(6-PHENOXY-3-PYRIDYL)ACRYLIC ACID

Description:
3-(6-Phenoxy-3-pyridyl)acrylic acid is an organic compound characterized by its unique structure, which includes a pyridine ring and a phenoxy group attached to an acrylic acid moiety. This compound typically exhibits properties such as being a solid at room temperature and possessing moderate solubility in organic solvents, while its solubility in water may vary. The presence of the phenoxy and pyridine groups contributes to its potential as a ligand in coordination chemistry and its utility in various biological applications, including as a pharmaceutical intermediate. The compound may also exhibit specific reactivity due to the presence of the acrylic acid functional group, which can participate in various chemical reactions, such as polymerization or esterification. Additionally, its molecular structure suggests potential for hydrogen bonding and other intermolecular interactions, influencing its physical and chemical behavior. Overall, 3-(6-phenoxy-3-pyridyl)acrylic acid is of interest in both synthetic organic chemistry and medicinal chemistry due to its diverse functional groups and potential applications.
Formula:C14H11NO3
InChI:InChI=1/C14H11NO3/c16-14(17)9-7-11-6-8-13(15-10-11)18-12-4-2-1-3-5-12/h1-10H,(H,16,17)/b9-7+
Synonyms:
  • Rarechem Al Bk 1323
  • (2E)-3-(6-phenoxypyridin-3-yl)prop-2-enoic acid
Found 1 products.