CymitQuimica logo

CAS 118427-36-4

:

4-Pentenoic acid, 4-chloro-2,2-dimethyl- ethyl ester

Description:
4-Pentenoic acid, 4-chloro-2,2-dimethyl-ethyl ester, identified by CAS number 118427-36-4, is an organic compound characterized by its ester functional group and a pentenoic acid backbone. This compound features a double bond in the pentenoic acid chain, which contributes to its reactivity and potential applications in organic synthesis. The presence of a chlorine atom and two methyl groups on the carbon chain enhances its chemical properties, influencing its polarity and solubility in various solvents. Typically, esters like this one are known for their pleasant odors and are often used in flavoring and fragrance applications. Additionally, the structural features suggest potential utility in polymer chemistry or as intermediates in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as the chlorine substituent may impart specific hazards. Overall, this compound exemplifies the diverse chemistry of esters and their functional derivatives in organic synthesis and industrial applications.
Formula:C9H15ClO2
InChI:InChI=1/C9H15ClO2/c1-5-12-8(11)9(3,4)6-7(2)10/h2,5-6H2,1,3-4H3
InChI key:QVPAHMHJYDYAOS-UHFFFAOYSA-N
SMILES:CCOC(=O)C(C)(C)CC(=C)Cl
Synonyms:
  • Ethyl 4-Chloro-2,2-Dimethylpent-4-Enoate
Found 3 products.