CymitQuimica logo

CAS 1184472-20-5

:

(bromophenyl)ethanolamine

Description:
Bromophenyl)ethanolamine, identified by its CAS number 1184472-20-5, is a chemical compound that features both bromine and phenyl groups attached to an ethanolamine structure. This compound typically exhibits characteristics common to amines, such as basicity and the ability to form hydrogen bonds due to the presence of the hydroxyl (-OH) group. The bromine substituent can influence the compound's reactivity and solubility, often enhancing its lipophilicity. As a result, bromophenyl)ethanolamine may exhibit unique biological activities, making it of interest in pharmaceutical research. The presence of the phenyl group can also contribute to its aromatic properties, potentially affecting its interaction with biological targets. Additionally, the compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Overall, bromophenyl)ethanolamine is a versatile compound with potential applications in medicinal chemistry and material science, warranting further investigation into its properties and uses.
Formula:C8H10BrNO
InChI:InChI=1S/C8H10BrNO/c9-7-4-2-1-3-6(7)8(10)5-11/h1-4,8,11H,5,10H2
InChI key:VUSFGKBTMASDCO-UHFFFAOYSA-N
SMILES:c1ccc(c(c1)C(CO)N)Br
Found 3 products.