CymitQuimica logo

CAS 118469-15-1

:

5-FLUORO-2-METHYLBENZIMIDAZOLE

Description:
5-Fluoro-2-methylbenzimidazole is a chemical compound characterized by its fused bicyclic structure, which consists of a benzene ring and an imidazole ring. The presence of a fluorine atom at the 5-position and a methyl group at the 2-position of the benzimidazole framework contributes to its unique chemical properties. This compound is typically a white to off-white solid and is known for its potential applications in pharmaceuticals, particularly in the development of antifungal and anticancer agents. Its molecular structure allows for various interactions with biological targets, making it a subject of interest in medicinal chemistry. The compound is soluble in organic solvents, and its reactivity can be influenced by the substituents on the aromatic ring. Safety data indicates that, like many fluorinated compounds, it should be handled with care due to potential toxicity and environmental impact. Overall, 5-fluoro-2-methylbenzimidazole represents a significant compound in the field of organic chemistry and drug development.
Formula:C8H7FN2
InChI:InChI=1S/C8H7FN2/c1-5-10-7-3-2-6(9)4-8(7)11-5/h2-4H,1H3,(H,10,11)
InChI key:IWDUKSHNFODGKM-UHFFFAOYSA-N
SMILES:CC1=NC2=C(N1)C=C(C=C2)F
Synonyms:
  • 5-Fluoro-2-Methyl-1H-Benzimidazole
  • 1H-Benzimidazole,5-fluoro-2-methyl-(9CI)
Found 4 products.