CymitQuimica logo

CAS 118474-44-5

:

1H-Imidazole-2-carboxaldehyde,4,5-dimethyl-

Description:
1H-Imidazole-2-carboxaldehyde, 4,5-dimethyl- is an organic compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a carboxaldehyde functional group (-CHO) at the 2-position and two methyl groups at the 4 and 5 positions of the imidazole ring. The presence of these functional groups contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The compound is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the aldehyde and carboxylic functionalities. Its unique structure allows it to participate in various chemical reactions, including condensation and substitution reactions, making it a valuable intermediate in the synthesis of more complex molecules. Additionally, compounds with imidazole rings are often studied for their biological activities, including antimicrobial and antifungal properties, which may also apply to this specific derivative.
Formula:C6H8N2O
InChI:InChI=1S/C6H8N2O/c1-4-5(2)8-6(3-9)7-4/h3H,1-2H3,(H,7,8)
InChI key:BOXPJRBSLSQXKA-UHFFFAOYSA-N
SMILES:CC1=C(N=C(N1)C=O)C
Found 2 products.