CymitQuimica logo

CAS 1184754-51-5

:

Methyl 4-amino-3-(2,2-difluoroethoxy)benzoate

Description:
Methyl 4-amino-3-(2,2-difluoroethoxy)benzoate is an organic compound characterized by its aromatic structure, which includes a benzoate moiety with an amino group and a difluoroethoxy substituent. The presence of the amino group (-NH2) indicates potential basicity and reactivity, particularly in forming salts or participating in nucleophilic reactions. The difluoroethoxy group introduces significant electronegativity due to the fluorine atoms, which can influence the compound's polarity and solubility in various solvents. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in the design of compounds with specific biological activities. Additionally, the methyl ester functionality can be hydrolyzed to yield the corresponding carboxylic acid, further expanding its utility in synthetic chemistry. Overall, Methyl 4-amino-3-(2,2-difluoroethoxy)benzoate presents a unique combination of functional groups that can be leveraged for various chemical reactions and applications.
Formula:C10H11F2NO3
InChI:InChI=1S/C10H11F2NO3/c1-15-10(14)6-2-3-7(13)8(4-6)16-5-9(11)12/h2-4,9H,5,13H2,1H3
InChI key:InChIKey=KCMYRZFFXJTHIB-UHFFFAOYSA-N
SMILES:O(CC(F)F)C1=CC(C(OC)=O)=CC=C1N
Synonyms:
  • Benzoic acid, 4-amino-3-(2,2-difluoroethoxy)-, methyl ester
  • Methyl 4-amino-3-(2,2-difluoroethoxy)benzoate
Found 1 products.