CymitQuimica logo

CAS 1184913-75-4

:

2-fluoro-5-iodo-4-methylpyridine

Description:
2-Fluoro-5-iodo-4-methylpyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with a fluorine atom at the 2-position, an iodine atom at the 5-position, and a methyl group at the 4-position. This compound exhibits properties typical of halogenated pyridines, including potential reactivity in nucleophilic substitution reactions due to the presence of the electronegative fluorine and iodine atoms. The presence of these halogens can influence the compound's polarity, solubility, and overall reactivity, making it of interest in various chemical syntheses and applications, particularly in pharmaceuticals and agrochemicals. Additionally, the methyl group can affect the steric and electronic properties of the molecule, potentially enhancing its biological activity. The compound's unique combination of substituents may also impart specific characteristics such as increased lipophilicity or altered binding affinities in biological systems. Overall, 2-fluoro-5-iodo-4-methylpyridine is a valuable compound for research and development in organic chemistry and related fields.
Formula:C6H5FIN
InChI:InChI=1S/C6H5FIN/c1-4-2-6(7)9-3-5(4)8/h2-3H,1H3
InChI key:KGSVFCIENPUKHY-UHFFFAOYSA-N
SMILES:CC1=CC(=NC=C1I)F
Found 4 products.