CymitQuimica logo

CAS 1184915-45-4

:

2-Bromo-3-fluorobenzyl alcohol

Description:
2-Bromo-3-fluorobenzyl alcohol is an organic compound characterized by the presence of both bromine and fluorine substituents on a benzyl alcohol structure. The compound features a benzene ring with a hydroxymethyl group (-CH2OH) attached to it, along with a bromine atom at the second position and a fluorine atom at the third position relative to the hydroxymethyl group. This substitution pattern can influence the compound's reactivity, polarity, and solubility. Typically, compounds like 2-Bromo-3-fluorobenzyl alcohol exhibit moderate to high polarity due to the hydroxyl group, which can engage in hydrogen bonding. The presence of halogens (bromine and fluorine) can also enhance the compound's reactivity in various chemical reactions, such as nucleophilic substitutions or coupling reactions. Additionally, the compound may have applications in medicinal chemistry and material science due to its unique structural features. Safety data should be consulted for handling and storage, as halogenated compounds can pose specific health and environmental risks.
Formula:C7H6BrFO
InChI:InChI=1S/C7H6BrFO/c8-7-5(4-10)2-1-3-6(7)9/h1-3,10H,4H2
InChI key:WGBLBANWTOEASN-UHFFFAOYSA-N
SMILES:C1=CC(=C(C(=C1)F)Br)CO
Synonyms:
  • (2-Bromo-3-fluorophenyl)methanol
Found 5 products.