CymitQuimica logo

CAS 1184916-59-3

:

6-(trifluoromethyl)isoquinolin-1(2H)-one

Description:
6-(Trifluoromethyl)isoquinolin-1(2H)-one is a chemical compound characterized by its isoquinoline structure, which consists of a fused bicyclic system containing a benzene ring and a pyridine ring. The presence of a trifluoromethyl group (-CF3) at the 6-position significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its reactivity and biological activity. This compound typically exhibits a solid state at room temperature and may be soluble in organic solvents. Its functional groups suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the trifluoromethyl moiety's ability to modulate biological interactions. Additionally, the compound may exhibit interesting electronic properties due to the electron-withdrawing nature of the trifluoromethyl group, which can influence the compound's reactivity in various chemical reactions. Overall, 6-(trifluoromethyl)isoquinolin-1(2H)-one is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C10H6F3NO
InChI:InChI=1S/C10H6F3NO/c11-10(12,13)7-1-2-8-6(5-7)3-4-14-9(8)15/h1-5H,(H,14,15)
InChI key:VOZOQWOUOOVFSB-UHFFFAOYSA-N
SMILES:C1=CC2=C(C=CNC2=O)C=C1C(F)(F)F
Found 3 products.