CymitQuimica logo

CAS 1184937-19-6

:

Benzenamine, 2-bromo-4-fluoro-, hydrochloride (1:1)

Description:
Benzenamine, 2-bromo-4-fluoro-, hydrochloride (1:1), also known by its CAS number 1184937-19-6, is an organic compound characterized by the presence of a benzene ring substituted with both a bromine and a fluorine atom, as well as an amino group. The hydrochloride form indicates that the compound exists as a salt, which enhances its solubility in water and may influence its stability and reactivity. This compound typically exhibits properties associated with aromatic amines, such as potential basicity due to the amino group, and it may participate in electrophilic aromatic substitution reactions. The presence of halogen substituents (bromine and fluorine) can significantly affect the compound's reactivity, polarity, and overall chemical behavior. Additionally, the hydrochloride form can impact its pharmacological properties, making it of interest in medicinal chemistry. Safety considerations should be taken into account, as halogenated compounds can exhibit toxicity and environmental persistence. Overall, this compound's unique structure and properties make it relevant in various chemical and pharmaceutical applications.
Formula:C6H5BrFN·ClH
InChI:InChI=1S/C6H5BrFN.ClH/c7-5-3-4(8)1-2-6(5)9;/h1-3H,9H2;1H
InChI key:InChIKey=NTLUSHRFXLSKIZ-UHFFFAOYSA-N
SMILES:BrC1=C(N)C=CC(F)=C1.Cl
Synonyms:
  • Benzenamine, 2-bromo-4-fluoro-, hydrochloride (1:1)
Found 2 products.