CymitQuimica logo

CAS 118499-01-7

:

2-[(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-1-yl)amino]ethanol

Description:
2-[(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-1-yl)amino]ethanol, with the CAS number 118499-01-7, is an organic compound characterized by its complex structure, which includes a carbazole moiety and an amino alcohol functional group. This substance typically exhibits properties associated with both amines and alcohols, such as the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the tetrahydrocarbazole structure suggests potential biological activity, as carbazole derivatives are often studied for their pharmacological properties. The compound may be a solid at room temperature, with potential applications in medicinal chemistry or as an intermediate in organic synthesis. Its specific melting point, boiling point, and solubility characteristics would depend on the purity and specific conditions of the environment. Safety data should be consulted for handling and storage, as compounds with amine functionalities can be sensitive to moisture and air. Overall, this compound represents a unique blend of structural features that may contribute to its chemical behavior and potential applications.
Formula:C15H20N2O
InChI:InChI=1/C15H20N2O/c1-10-5-6-13-12(9-10)11-3-2-4-14(15(11)17-13)16-7-8-18/h5-6,9,14,16-18H,2-4,7-8H2,1H3
SMILES:Cc1ccc2c(c1)c1CCCC(c1[nH]2)NCCO
Synonyms:
  • 2-(6-Methyl-2,3,4,9-tetrahydro-1H-carbazol-1-ylamino)-ethanol
Found 1 products.