CymitQuimica logo

CAS 118499-70-0

:

2,3,5,6,7,8-Hexahydro-1H-cyclopenta[b]quinolin-9-amine hydrochloride hydrate (1:1:1)

Description:
2,3,5,6,7,8-Hexahydro-1H-cyclopenta[b]quinolin-9-amine hydrochloride hydrate is a chemical compound characterized by its complex bicyclic structure, which includes a cyclopentaquinoline framework. This compound is typically encountered as a hydrochloride salt, indicating that it is protonated and exists in a hydrated form, which can influence its solubility and stability. The presence of multiple hydrogen atoms in its structure suggests that it may exhibit basic properties, allowing it to form salts with acids. The compound is likely to be a solid at room temperature and may have applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its potential biological activity. Its specific interactions, reactivity, and pharmacological properties would depend on the functional groups present and the overall molecular conformation. As with many organic compounds, safety data and handling precautions should be considered, especially when dealing with its hydrochloride form.
Formula:C12H19ClN2O
InChI:InChI=1/C12H16N2.ClH.H2O/c13-12-8-4-1-2-6-10(8)14-11-7-3-5-9(11)12;;/h1-7H2,(H2,13,14);1H;1H2
InChI key:SBTIBNSPYUUNGA-UHFFFAOYSA-N
SMILES:C1CCc2c(C1)c(=N)c1CCCc1[nH]2.Cl.O
Synonyms:
  • 9-Amino-2,3,5,6,7,8-hexahydro-1H-cyclopenta[b]quinoline hydrochloride monohydrate
  • Ipidacrine hydrochloride hydrate
  • 2,3,5,6,7,8-hexahydro-1H-cyclopenta[b]quinolin-9-amine hydrochloride hydrate
Found 8 products.