CymitQuimica logo

CAS 1185149-23-8

:

{3-[(Dimethylamino)methyl]benzyl}methylaminedihydrochloride

Description:
{3-[(Dimethylamino)methyl]benzyl}methylaminedihydrochloride, with the CAS number 1185149-23-8, is a chemical compound characterized by its structure, which includes a benzyl group substituted with a dimethylamino group and a methylamine moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the dihydrochloride salt form, which enhances its solubility and stability. It is often used in pharmaceutical research and development, particularly in the synthesis of various biologically active compounds. The presence of the dimethylamino group suggests potential basic properties, allowing it to interact with various biological targets. Additionally, the compound may exhibit specific pharmacological activities, although detailed studies would be necessary to elucidate its full biological profile. As with many amine-containing compounds, it may also be sensitive to oxidation and should be handled with care in a controlled laboratory environment.
Formula:C11H20Cl2N2
InChI:InChI=1S/C11H18N2.2ClH/c1-12-8-10-5-4-6-11(7-10)9-13(2)3;;/h4-7,12H,8-9H2,1-3H3;2*1H
InChI key:OWPZIFYCXYKEHY-UHFFFAOYSA-N
SMILES:CNCC1=CC(=CC=C1)CN(C)C.Cl.Cl
Synonyms:
  • 1-[3-[(dimethylamino)methyl]phenyl]-N-methylmethanamine:dihydrochloride
  • N,N-Dimethyl-1-(3-((methylamino)methyl)phenyl)methanamine dihydrochloride
Found 2 products.