CAS 1185282-03-4
:N-[(1S)-2-Amino-2-oxo-1-(phenylmethyl)ethyl]-1-[(4-fluorophenyl)methyl]-1H-indazole-3-carboxamide
Description:
N-[(1S)-2-Amino-2-oxo-1-(phenylmethyl)ethyl]-1-[(4-fluorophenyl)methyl]-1H-indazole-3-carboxamide is a complex organic compound characterized by its specific structural features, including an indazole core, an amide functional group, and a chiral amino acid derivative. The presence of a fluorinated phenyl group enhances its potential biological activity, possibly influencing its pharmacokinetic properties. This compound is likely to exhibit a range of polar and non-polar characteristics due to the diverse functional groups present, which may affect its solubility in various solvents. The chiral center indicates that it may exist in enantiomeric forms, which can have different biological effects. Such compounds are often investigated for their potential therapeutic applications, particularly in fields like medicinal chemistry and drug development. The specific interactions of this compound with biological targets would depend on its three-dimensional conformation and the nature of its substituents, making it a subject of interest for further research in pharmacology and biochemistry.
Formula:C24H21FN4O2
InChI:InChI=1S/C24H21FN4O2/c25-18-12-10-17(11-13-18)15-29-21-9-5-4-8-19(21)22(28-29)24(31)27-20(23(26)30)14-16-6-2-1-3-7-16/h1-13,20H,14-15H2,(H2,26,30)(H,27,31)/t20-/m0/s1
InChI key:InChIKey=TZXBEYFALIFOAG-FQEVSTJZSA-N
SMILES:C(N[C@@H](CC1=CC=CC=C1)C(N)=O)(=O)C=2C=3C(N(CC4=CC=C(F)C=C4)N2)=CC=CC3
Synonyms:- N-[(1S)-2-Amino-2-oxo-1-(phenylmethyl)ethyl]-1-[(4-fluorophenyl)methyl]-1H-indazole-3-carboxamide
- 1H-Indazole-3-carboxamide, N-[(1S)-2-amino-2-oxo-1-(phenylmethyl)ethyl]-1-[(4-fluorophenyl)methyl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
APP-FUBINACA
CAS:APP-FUBINACA is a cannabinoid receptor agonist, classified as a phenylalanine amide-based indazole-3-carboxamide derivative. It exhibits neurostimulatory effects.Formula:C24H21FN4O2Color and Shape:SolidMolecular weight:416.45APP-FUBINACA
CAS:Controlled Product<p>APP-FUBINACA is a synthetic cannabinoid that can interact with the CB2 receptor, which belongs to the group of G protein coupled receptors. APP-FUBINACA has been shown to be potent antagonists of this receptor and is believed to be responsible for many of the adverse effects such as hallucinations, anxiety, and paranoia. APP-FUBINACA can also interact with other receptors including adrenergic receptors, serotonin receptors, dopamine receptors and opioid receptors. This drug has been shown to cause symptoms such as nausea, vomiting, agitation and insomnia. The histology of human liver cells treated with APP-FUBINACA have shown hallmarks consistent with necrosis and apoptosis. This drug is expressed in the human liver and may contribute to lesions in this area caused by chronic abuse of marijuana or other cannabinoids.</p>Purity:Min. 95%APP-FUBINACA RM
CAS:Controlled Product<p>Applications APP-FUBINACA RM is an analog of AB-FUBINACA which is an indazole derivative developed as a CB1 receptor modulator used in the treatment of CB1-mediated diseases. Synthetic cannabinoids<br>References Nahoko, U., et al.: Forensic. Toxicol., 31, 93 (2013);<br></p>Formula:C24H21FN4O2Color and Shape:NeatMolecular weight:416.50


