CAS 1185282-03-4
:N-[(1S)-2-Amino-2-oxo-1-(phenylmethyl)ethyl]-1-[(4-fluorophenyl)methyl]-1H-indazole-3-carboxamide
Description:
N-[(1S)-2-Amino-2-oxo-1-(phenylmethyl)ethyl]-1-[(4-fluorophenyl)methyl]-1H-indazole-3-carboxamide is a complex organic compound characterized by its specific structural features, including an indazole core, an amide functional group, and a chiral amino acid derivative. The presence of a fluorinated phenyl group enhances its potential biological activity, possibly influencing its pharmacokinetic properties. This compound is likely to exhibit a range of polar and non-polar characteristics due to the diverse functional groups present, which may affect its solubility in various solvents. The chiral center indicates that it may exist in enantiomeric forms, which can have different biological effects. Such compounds are often investigated for their potential therapeutic applications, particularly in fields like medicinal chemistry and drug development. The specific interactions of this compound with biological targets would depend on its three-dimensional conformation and the nature of its substituents, making it a subject of interest for further research in pharmacology and biochemistry.
Formula:C24H21FN4O2
InChI:InChI=1S/C24H21FN4O2/c25-18-12-10-17(11-13-18)15-29-21-9-5-4-8-19(21)22(28-29)24(31)27-20(23(26)30)14-16-6-2-1-3-7-16/h1-13,20H,14-15H2,(H2,26,30)(H,27,31)/t20-/m0/s1
InChI key:InChIKey=TZXBEYFALIFOAG-FQEVSTJZSA-N
SMILES:C(N[C@@H](CC1=CC=CC=C1)C(N)=O)(=O)C=2C=3C(N(CC4=CC=C(F)C=C4)N2)=CC=CC3
Synonyms:- N-[(1S)-2-Amino-2-oxo-1-(phenylmethyl)ethyl]-1-[(4-fluorophenyl)methyl]-1H-indazole-3-carboxamide
- 1H-Indazole-3-carboxamide, N-[(1S)-2-amino-2-oxo-1-(phenylmethyl)ethyl]-1-[(4-fluorophenyl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
APP-FUBINACA
CAS:APP-FUBINACA is a cannabinoid receptor agonist, classified as a phenylalanine amide-based indazole-3-carboxamide derivative. It exhibits neurostimulatory effects.Formula:C24H21FN4O2Color and Shape:SolidMolecular weight:416.45APP-FUBINACA RM
CAS:Controlled ProductApplications APP-FUBINACA RM is an analog of AB-FUBINACA which is an indazole derivative developed as a CB1 receptor modulator used in the treatment of CB1-mediated diseases. Synthetic cannabinoids
References Nahoko, U., et al.: Forensic. Toxicol., 31, 93 (2013);Formula:C24H21FN4O2Color and Shape:NeatMolecular weight:416.50

