CymitQuimica logo

CAS 1185293-23-5

:

1-Isopropyl-1H-pyrazol-4-aMine hydrochloride

Description:
1-Isopropyl-1H-pyrazol-4-amine hydrochloride is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features an isopropyl group attached to the pyrazole at the 1-position and an amino group at the 4-position, contributing to its basicity and potential reactivity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The presence of the amino group allows for hydrogen bonding, which can influence its interaction with biological targets. This compound may exhibit properties such as moderate to high stability under standard conditions, but its reactivity can vary based on environmental factors. Additionally, it may be used in research settings for its potential biological activities, although specific applications would depend on ongoing studies and findings related to its pharmacological profile. Safety data and handling precautions should be observed, as with any chemical substance.
Formula:C6H12ClN3
InChI:InChI=1S/C6H11N3.ClH/c1-5(2)9-4-6(7)3-8-9;/h3-5H,7H2,1-2H3;1H
InChI key:OHQZEIIBJIFRHV-UHFFFAOYSA-N
SMILES:CC(C)N1C=C(C=N1)N.Cl
Synonyms:
  • 1-Isopropyl-1H-pyrazol-4-aMine hydrochloride
  • 4-AMino-1-isopropylpyrazole HCl
Found 5 products.