CymitQuimica logo

CAS 1185302-60-6

:

Piperidine, 1-(4-fluoro-2-nitrophenyl)-2-methyl-, hydrochloride (1:1)

Description:
Piperidine, 1-(4-fluoro-2-nitrophenyl)-2-methyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a 4-fluoro-2-nitrophenyl group indicates the substitution of a fluorine atom and a nitro group on the aromatic ring, contributing to its unique chemical properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and research. The compound may exhibit specific pharmacological effects due to its structural features, making it of interest in medicinal chemistry. Its molecular interactions, stability, and reactivity can be influenced by the functional groups present, and it may undergo various chemical reactions typical of both piperidine derivatives and nitrophenyl compounds. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity.
Formula:C12H15FN2O2·ClH
InChI:InChI=1S/C12H15FN2O2.ClH/c1-9-4-2-3-7-14(9)11-6-5-10(13)8-12(11)15(16)17;/h5-6,8-9H,2-4,7H2,1H3;1H
InChI key:InChIKey=YDABYAZAEDSMSY-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C=CC(F)=C1)N2C(C)CCCC2.Cl
Synonyms:
  • Piperidine, 1-(4-fluoro-2-nitrophenyl)-2-methyl-, hydrochloride (1:1)
Found 2 products.