CymitQuimica logo

CAS 1185302-61-7

:

4-Piperidinamine, 1-[(2-fluorophenyl)methyl]-, hydrochloride (1:2)

Description:
4-Piperidinamine, 1-[(2-fluorophenyl)methyl]-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a 2-fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring, influencing the compound's electronic properties and potentially its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, possibly influencing neurotransmitter systems or other pathways. Safety and handling precautions are essential, as with many amines and their derivatives, due to potential toxicity or reactivity. Further characterization, including spectral analysis and biological testing, would provide more insight into its specific properties and applications.
Formula:C12H17FN2·2ClH
InChI:InChI=1S/C12H17FN2.2ClH/c13-12-4-2-1-3-10(12)9-15-7-5-11(14)6-8-15;;/h1-4,11H,5-9,14H2;2*1H
InChI key:InChIKey=HUUXUEJYEJNIOX-UHFFFAOYSA-N
SMILES:C(C1=C(F)C=CC=C1)N2CCC(N)CC2.Cl
Synonyms:
  • 4-Piperidinamine, 1-[(2-fluorophenyl)methyl]-, hydrochloride (1:2)
Found 2 products.