
CAS 1185312-66-6
:1-Pyridin-2-ylMethyl-piperidin-3-ylaMine dihydrochloride, 98+% C11H19Cl2N3, MW: 264.19
Description:
1-Pyridin-2-ylmethyl-piperidin-3-ylamine dihydrochloride is a chemical compound characterized by its molecular formula C11H19Cl2N3 and a molecular weight of approximately 264.19 g/mol. This compound features a piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle, and a pyridine moiety, which is a five-membered aromatic ring with one nitrogen atom. The presence of two hydrochloride groups indicates that the compound is a salt, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The compound is typically used in research and development, potentially as a building block in the synthesis of more complex molecules or as a pharmacological agent. Its purity is noted to be 98% or higher, which is crucial for ensuring consistent performance in experimental settings. Safety data should be consulted for handling and storage, as with any chemical substance, to mitigate risks associated with its use.
Formula:C11H19Cl2N3
InChI:InChI=1S/C11H17N3.2ClH/c12-10-4-3-7-14(8-10)9-11-5-1-2-6-13-11;;/h1-2,5-6,10H,3-4,7-9,12H2;2*1H
InChI key:HVRNLGAVKHNFDT-UHFFFAOYSA-N
SMILES:C1CC(CN(C1)CC2=CC=CC=N2)N.Cl.Cl
Synonyms:- 1-(PYRIDIN-2-YLMETHYL)PIPERIDIN-3-AMINE DIHYDROCHLORIDE
- 1-Pyridin-2-ylMethyl-piperidin-3-ylaMine dihydrochloride, 98+% C11H19Cl2N3, MW: 264.19
- 1-(2-Pyridinylmethyl)-3-piperidinamine hydrochloride
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1-(Pyridin-2-ylmethyl)piperidin-3-amine dihydrochloride
CAS:Formula:C11H19Cl2N3Molecular weight:264.1947

