CAS 118543-96-7
:Pyrazinecarboxylic acid, 5-acetyl- (9CI)
Description:
Pyrazinecarboxylic acid, 5-acetyl- (9CI), with the CAS number 118543-96-7, is an organic compound characterized by its pyrazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound features a carboxylic acid functional group and an acetyl group, contributing to its reactivity and potential applications in various chemical reactions. Typically, pyrazine derivatives exhibit properties such as moderate solubility in polar solvents and varying degrees of acidity due to the presence of the carboxylic acid group. The acetyl group can influence the compound's reactivity, making it a potential candidate for synthesis in pharmaceuticals or agrochemicals. Additionally, pyrazine derivatives are known for their biological activity, which may include antimicrobial or anti-inflammatory properties. The specific characteristics, such as melting point, boiling point, and spectral data, would depend on the compound's purity and the conditions under which it is analyzed. Overall, pyrazinecarboxylic acid, 5-acetyl- is a versatile compound with potential applications in organic synthesis and medicinal chemistry.
Formula:C7H6N2O3
InChI:InChI=1S/C7H6N2O3/c1-4(10)5-2-9-6(3-8-5)7(11)12/h2-3H,1H3,(H,11,12)
InChI key:HMUCEWYEXBWAGY-UHFFFAOYSA-N
SMILES:CC(=O)C1=CN=C(C=N1)C(=O)O
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
