CymitQuimica logo

CAS 118553-99-4

:

H-Orn(2-Cl-Z)-OH

Description:
The chemical substance known as H-Orn(2-Cl-Z)-OH, with the CAS number 118553-99-4, is a derivative of ornithine, an amino acid that plays a crucial role in the urea cycle and protein synthesis. This compound features a chlorinated phenyl group, indicated by the "2-Cl-Z" notation, which suggests the presence of a chlorine atom substituted at the second position of a phenyl ring. The "H-" prefix denotes that it is in its free amino acid form, while the "OH" indicates the presence of a hydroxyl group, suggesting potential for hydrogen bonding and solubility in polar solvents. The structural modifications impart specific biological activities, making it of interest in pharmaceutical research, particularly in the development of peptide-based drugs or as a biochemical probe. Its unique characteristics, including its molecular weight, solubility, and reactivity, are influenced by the functional groups present, which can affect its interaction with biological systems and its overall stability.
Formula:C13H17ClN2O4
InChI:InChI=1/C13H17ClN2O4/c14-10-5-2-1-4-9(10)8-20-13(19)16-7-3-6-11(15)12(17)18/h1-2,4-5,11H,3,6-8,15H2,(H,16,19)(H,17,18)/t11-/m0/s1
InChI key:TWPRGWUUQAAZHW-NSHDSACASA-N
SMILES:c1ccc(c(c1)COC(=NCCC[C@@H](C(=O)O)N)O)Cl
Synonyms:
  • N-Delta-(2-Chlorobenzyloxycarbonyl)-L-Ornithine
  • (2S)-2-amino-5-[(2-chlorophenyl)methoxycarbonylamino]pentanoic acid
  • Ndelta-(2-Chlorobenzyloxycarbonyl)-L-Ornithine
Found 5 products.