CymitQuimica logo

CAS 118555-82-1

:

Benzeneacetic acid, 2-(b-D-glucopyranosyloxy)-5-hydroxy-

Description:
Benzeneacetic acid, 2-(β-D-glucopyranosyloxy)-5-hydroxy- is a chemical compound characterized by its complex structure, which includes a benzene ring, an acetic acid moiety, and a glucopyranosyl group. This compound features a hydroxyl group at the 5-position of the benzene ring, contributing to its potential reactivity and solubility in polar solvents. The presence of the β-D-glucopyranosyloxy group indicates that it is a glycoside, which may enhance its biological activity and solubility in aqueous environments. The molecular structure suggests that it may participate in hydrogen bonding due to the hydroxyl groups, influencing its interactions with other molecules. This compound may exhibit various biological activities, making it of interest in pharmaceutical and biochemical research. Its CAS number, 118555-82-1, allows for easy identification in chemical databases. Overall, the unique combination of functional groups in this compound suggests potential applications in medicinal chemistry and natural product synthesis.
Formula:C14H18O9
InChI:InChI=1S/C14H18O9/c15-5-9-11(19)12(20)13(21)14(23-9)22-8-2-1-7(16)3-6(8)4-10(17)18/h1-3,9,11-16,19-21H,4-5H2,(H,17,18)/t9-,11-,12+,13-,14-/m1/s1
InChI key:MVFYXXNAFZRZAM-RGCYKPLRSA-N
SMILES:C1=CC(=C(C=C1O)CC(=O)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O
Synonyms:
  • Phaseoloidin
Found 6 products.