CymitQuimica logo

CAS 1185726-73-1

:

Butyl 4-butoxybenzeneacetate

Description:
Butyl 4-butoxybenzeneacetate, identified by its CAS number 1185726-73-1, is an organic compound characterized by its ester functional group. This substance typically appears as a colorless to pale yellow liquid with a pleasant odor, making it suitable for use in various applications, including as a fragrance or flavoring agent. Its molecular structure consists of a butyl group attached to a 4-butoxybenzeneacetate moiety, which contributes to its solubility in organic solvents while being less soluble in water. The compound exhibits moderate volatility and can undergo hydrolysis in the presence of moisture, leading to the formation of the corresponding alcohol and acid. Its chemical stability is generally good under standard conditions, but it should be stored away from strong oxidizing agents and extreme temperatures. Safety data indicates that, like many esters, it may cause irritation upon contact with skin or eyes, and appropriate handling precautions should be taken. Overall, Butyl 4-butoxybenzeneacetate is valued for its functional properties in various industrial and consumer applications.
Formula:C16H24O3
InChI:InChI=1S/C16H24O3/c1-3-5-11-18-15-9-7-14(8-10-15)13-16(17)19-12-6-4-2/h7-10H,3-6,11-13H2,1-2H3
InChI key:InChIKey=XANNDSOAOAKZDI-UHFFFAOYSA-N
SMILES:C(C(OCCCC)=O)C1=CC=C(OCCCC)C=C1
Synonyms:
  • Benzeneacetic acid, 4-butoxy-, butyl ester
  • Butyl 4-butoxybenzeneacetate
Found 4 products.