CymitQuimica logo

CAS 1185883-40-2

:

(S)-3-((2R,5S)-5-(4-fluorophenyl)-2-((S)-(4-fluorophenylaMino)(4-hydroxyphenyl)Methyl)-5-hydroxypentanoyl)-4-phenyloxazolidin-2-one

Description:
The chemical substance known as (S)-3-((2R,5S)-5-(4-fluorophenyl)-2-((S)-(4-fluorophenylamino)(4-hydroxyphenyl)methyl)-5-hydroxypentanoyl)-4-phenyloxazolidin-2-one, with CAS number 1185883-40-2, is a complex organic compound characterized by its oxazolidinone core structure. This compound features multiple functional groups, including a hydroxyl group, amine, and aromatic rings, which contribute to its potential biological activity. The presence of fluorine atoms suggests enhanced lipophilicity and may influence the compound's pharmacokinetic properties. The stereochemistry indicated by the (S) and (R) designations implies specific spatial arrangements of atoms, which can significantly affect the compound's interaction with biological targets. Such compounds are often investigated for their potential as pharmaceuticals, particularly in the context of antibiotic development or as inhibitors in various biochemical pathways. The intricate structure and functionalization of this molecule suggest that it may exhibit unique properties, making it a subject of interest in medicinal chemistry and drug design.
Formula:C33H30F2N2O5
InChI:InChI=1S/C33H30F2N2O5/c34-24-10-6-22(7-11-24)30(39)19-18-28(32(40)37-29(20-42-33(37)41)21-4-2-1-3-5-21)31(23-8-16-27(38)17-9-23)36-26-14-12-25(35)13-15-26/h1-17,28-31,36,38-39H,18-20H2/t28-,29-,30+,31-/m1/s1
InChI key:WYMDQBFNYMAMNK-LTXXGDHTSA-N
SMILES:C1[C@@H](N(C(=O)O1)C(=O)[C@H](CC[C@@H](C2=CC=C(C=C2)F)O)[C@@H](C3=CC=C(C=C3)O)NC4=CC=C(C=C4)F)C5=CC=CC=C5
Found 5 products.