CymitQuimica logo

CAS 1185884-92-7

:

1,1-Dimethylethyl (2S)-2-(3-ethoxy-3-oxo-1-propyn-1-yl)-1-pyrrolidinecarboxylate

Description:
1,1-Dimethylethyl (2S)-2-(3-ethoxy-3-oxo-1-propyn-1-yl)-1-pyrrolidinecarboxylate, identified by its CAS number 1185884-92-7, is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring and various functional groups. The presence of the dimethyl group suggests a branched alkyl structure, contributing to its steric properties. The ethoxy group indicates the presence of an ether, which can influence solubility and reactivity. The compound features a propynyl moiety, which introduces unsaturation and potential sites for further chemical reactions. As a carboxylate ester, it may exhibit typical ester reactivity, such as hydrolysis under acidic or basic conditions. The stereochemistry indicated by the (2S) configuration suggests specific spatial arrangements that can affect the compound's biological activity and interactions. Overall, this compound's unique combination of functional groups and stereochemistry may render it of interest in synthetic organic chemistry and potential applications in pharmaceuticals or agrochemicals.
Formula:C14H21NO4
InChI:InChI=1S/C14H21NO4/c1-5-18-12(16)9-8-11-7-6-10-15(11)13(17)19-14(2,3)4/h11H,5-7,10H2,1-4H3/t11-/m0/s1
InChI key:PBXZNRBXEYZVAB-NSHDSACASA-N
SMILES:CCOC(=O)C#C[C@@H]1CCCN1C(=O)OC(C)(C)C
Synonyms:
  • 1,1-Dimethylethyl (2S)-2-(3-ethoxy-3-oxo-1-propyn-1-yl)-1-pyrrolidinecarboxylate
Found 4 products.