CymitQuimica logo

CAS 1186050-58-7

:

6-(2H-1,2,3-Triazole-2-yl)-fluorobenzoicacid

Description:
6-(2H-1,2,3-Triazole-2-yl)-fluorobenzoic acid is a chemical compound characterized by the presence of a fluorobenzoic acid moiety and a 1,2,3-triazole ring. The triazole ring contributes to its potential biological activity, as triazoles are known for their role in various pharmacological applications, including antifungal and anticancer properties. The fluorine atom in the benzoic acid structure can enhance the compound's lipophilicity and influence its reactivity and interaction with biological targets. This compound typically exhibits moderate solubility in polar solvents, and its acidic functional group allows for protonation under certain conditions, which can affect its behavior in biological systems. The presence of both the triazole and the fluorobenzoic acid functionalities suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Overall, the unique structural features of this compound make it a subject of interest for further research in various fields, including drug discovery and material science.
Formula:C9H6FN3O2
InChI:InChI=1S/C9H6FN3O2/c10-6-2-1-3-7(8(6)9(14)15)13-11-4-5-12-13/h1-5H,(H,14,15)
InChI key:NTPOZDBAGMLNQA-UHFFFAOYSA-N
SMILES:C1=CC(=C(C(=C1)F)C(=O)O)N2N=CC=N2
Found 3 products.