CymitQuimica logo

CAS 1186115-39-8

:

4-broMo-5-iodopyridin-2-aMine

Description:
4-Bromo-5-iodopyridin-2-amine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with bromine and iodine atoms, as well as an amino group. The molecular structure features a six-membered aromatic ring containing nitrogen, which contributes to its basicity and potential reactivity. The bromine and iodine substituents introduce significant steric and electronic effects, influencing the compound's reactivity and interactions in chemical reactions. This compound is typically used in medicinal chemistry and organic synthesis, often serving as an intermediate in the development of pharmaceuticals or agrochemicals. Its properties, such as solubility and stability, can vary depending on the solvent and conditions used. Additionally, the presence of halogens can enhance its biological activity, making it a subject of interest in drug discovery. Safety precautions should be taken when handling this compound, as halogenated compounds can pose health risks. Overall, 4-bromo-5-iodopyridin-2-amine exemplifies the complexity and utility of halogenated heterocycles in chemical research.
Formula:C5H4BrIN2
InChI:InChI=1S/C5H4BrIN2/c6-3-1-5(8)9-2-4(3)7/h1-2H,(H2,8,9)
InChI key:CKYRRNXPSWKRSC-UHFFFAOYSA-N
SMILES:C1=C(C(=CN=C1N)I)Br
Synonyms:
  • 4-broMo-5-iodopyridin-2-aMine
  • 4-BroMo-5-iodo-pyridin-2-ylaMine
Found 4 products.