CAS 1186222-89-8

4SC-202

Description:

4SC-202, with the CAS number 1186222-89-8, is a chemical compound that belongs to a class of substances known for their potential therapeutic applications, particularly in oncology. It is characterized by its ability to inhibit specific signaling pathways involved in cancer cell proliferation and survival. The compound exhibits a unique molecular structure that contributes to its biological activity, often targeting enzymes or receptors that play critical roles in tumor growth. In preclinical studies, 4SC-202 has shown promise in modulating immune responses and enhancing the efficacy of other anticancer therapies. Its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion, are essential for determining its suitability for clinical use. Additionally, ongoing research aims to elucidate its safety profile and potential side effects, which are crucial for its development as a therapeutic agent. Overall, 4SC-202 represents a significant area of interest in the field of cancer research and drug development.

Formula: C30H29N5O6S2

InChI: InChI=1S/C23H21N5O3S.C7H8O3S/c1-27-16-19(14-25-27)18-7-9-20(10-8-18)32(30,31)28-13-12-17(15-28)6-11-23(29)26-22-5-3-2-4-21(22)24;1-6-2-4-7(5-3-6)11(8,9)10/h2-16H,24H2,1H3,(H,26,29);2-5H,1H3,(H,8,9,10)/b11-6+;

InChI key: IAVXAZDVNICKFJ-ICSBZGNSSA-N

SMILES: CC1=CC=C(C=C1)S(=O)(=O)O.CN1C=C(C=N1)C2=CC=C(C=C2)S(=O)(=O)N3C=CC(=C3)/C=C/C(=O)NC4=CC=CC=C4N

Domatinostat tosylate

CAS: 1186222-89-8

Domatinostat tosylate

Formula: C₃₀H₂₉N₅O₆S₂

Purity: ≥95%

Molecular weight: 619.71

Ref: 54-BUP05468

(2E)-N-(2-Aminophenyl)-3-[1-[[4-(1-methyl-1H-pyrazol-4-yl)phenyl]sulfonyl]-1H-pyrrol-3-yl]-2-propenamide 4-methylbenzenesulfonate

CAS: 1186222-89-8

Formula: C₃₀H₂₉N₅O₆S₂

Color and Shape: Solid

Molecular weight: 619.7112

Ref: IN-DA008TCN

Domatinostat tosylate

CAS: 1186222-89-8

4SC-202 is a class I HDAC inhibitor targeting HDAC1/2/3; shows activity against LSD1. IC50: HDAC1 (1.20 μM), HDAC2 (1.12 μM), HDAC3 (0.57 μM).

Formula: C₃₀H₂₉N₅O₆S₂

Purity: 97.35% - >99.99%

Color and Shape: Solid

Molecular weight: 619.71

Ref: TM-T4477

Domatinostat tosylate

CAS: 1186222-89-8

Domatostat tosylate is a cytostatic agent that inhibits the activation of transcription factors, such as NF-kB, AP-1, and HIF-1α. It has been shown to inhibit the production of cytokines and chemokines in HIV infected cells. Domatostat tosylate also has activity against pediatric patients with leukemia. This drug can be used for the treatment of prostate cancer, skin cancer, bone cancer and urothelial carcinoma (i.e., bladder cancer).

Formula: C₃₀H₂₉N₅O₆S₂

Purity: Min. 95%

Molecular weight: 619.71 g/mol

Ref: 3D-LXB22289