CymitQuimica logo

CAS 1186605-87-7

:

methyl 6-chloro-4-methyl-pyridine-2-carboxylate

Description:
Methyl 6-chloro-4-methyl-pyridine-2-carboxylate is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a methyl group and a chloro substituent on the pyridine ring contributes to its unique chemical properties. This compound typically exhibits moderate polarity due to the presence of the carboxylate functional group, which can engage in hydrogen bonding and influence its solubility in various solvents. Methyl 6-chloro-4-methyl-pyridine-2-carboxylate may be used in synthetic organic chemistry as an intermediate for the preparation of other chemical entities, particularly in the development of pharmaceuticals or agrochemicals. Its reactivity can be attributed to the electrophilic nature of the chloro substituent, making it a potential candidate for nucleophilic substitution reactions. Additionally, the compound's stability and behavior under different conditions can be influenced by factors such as temperature, pH, and the presence of other reactive species.
Formula:C8H8ClNO2
InChI:InChI=1S/C8H8ClNO2/c1-5-3-6(8(11)12-2)10-7(9)4-5/h3-4H,1-2H3
InChI key:RSVVRJLGYCOGDB-UHFFFAOYSA-N
SMILES:CC1=CC(=NC(=C1)Cl)C(=O)OC
Found 4 products.